About O-benzyl N-benzylcarbamothioate
O-benzyl N-benzylcarbamothioate (PubChem CID 57114286) has the molecular formula C15H15NOS
and a molecular weight of 257.36 g/mol. Its IUPAC name is O-benzyl N-benzylcarbamothioate.
Molecular Properties
| Compound Name | O-benzyl N-benzylcarbamothioate |
| PubChem CID | 57114286 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | O-benzyl N-benzylcarbamothioate |
| SMILES | S=C(NCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C15H15NOS/c18-15(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,18) |
| InChIKey | SJWXRQVEBCCJTC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-benzyl N-benzylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-benzyl N-benzylcarbamothioate?
The IUPAC name of O-benzyl N-benzylcarbamothioate (CID 57114286) is O-benzyl N-benzylcarbamothioate.
What is the SMILES notation for O-benzyl N-benzylcarbamothioate?
The canonical SMILES for O-benzyl N-benzylcarbamothioate is S=C(NCc1ccccc1)OCc1ccccc1.
What is the InChIKey of O-benzyl N-benzylcarbamothioate?
The InChIKey is SJWXRQVEBCCJTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NOS/c18-15(16-11-13-7-3-1-4-8-13)17-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,16,18).
What are the key properties of O-benzyl N-benzylcarbamothioate?
O-benzyl N-benzylcarbamothioate has a molecular weight of 257.36 g/mol, XLogP of 3.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-benzyl N-benzylcarbamothioate is sourced from PubChem (CID 57114286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).