C11H12N4 — CID 57114569
6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-5-amine (PubChem CID 57114569) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-5-amine.
| Compound Name | 6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-5-amine |
|---|---|
| PubChem CID | 57114569 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6,7,8,9-tetrahydropyrimido[4,5-b]quinolin-5-amine |
| SMILES | Nc1c2c(nc3ncncc13)CCCC2 |
| InChI | InChI=1S/C11H12N4/c12-10-7-3-1-2-4-9(7)15-11-8(10)5-13-6-14-11/h5-6H,1-4H2,(H2,12,13,14,15) |
| InChIKey | XEWLCAGYRAPEMR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |