C15H22O — CID 57114577
(4aS,10aS)-5-methoxy-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene (PubChem CID 57114577) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (4aS,10aS)-5-methoxy-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene.
| Compound Name | (4aS,10aS)-5-methoxy-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene |
|---|---|
| PubChem CID | 57114577 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (4aS,10aS)-5-methoxy-1,2,3,4,4a,7,8,9,10,10a-decahydrophenanthrene |
| SMILES | COC1=CCCC2=C1[C@H]1CCCC[C@H]1CC2 |
| InChI | InChI=1S/C15H22O/c1-16-14-8-4-6-12-10-9-11-5-2-3-7-13(11)15(12)14/h8,11,13H,2-7,9-10H2,1H3/t11-,13-/m0/s1 |
| InChIKey | QUJNHSZEOCYBRQ-AAEUAGOBSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |