C23H34O5 — CID 57114795
[(4R)-4-hydroxy-4-methylnona-1,5,7-trienyl] 7-hydroxy-3-methyl-2-[(1R)-2-oxocyclopentyl]hept-2-enoate (PubChem CID 57114795) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(4R)-4-hydroxy-4-methylnona-1,5,7-trienyl] 7-hydroxy-3-methyl-2-[(1R)-2-oxocyclopentyl]hept-2-enoate.
| Compound Name | [(4R)-4-hydroxy-4-methylnona-1,5,7-trienyl] 7-hydroxy-3-methyl-2-[(1R)-2-oxocyclopentyl]hept-2-enoate |
|---|---|
| PubChem CID | 57114795 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(4R)-4-hydroxy-4-methylnona-1,5,7-trienyl] 7-hydroxy-3-methyl-2-[(1R)-2-oxocyclopentyl]hept-2-enoate |
| SMILES | CC=CC=C[C@](C)(O)CC=COC(=O)C(=C(C)CCCCO)[C@H]1CCCC1=O |
| InChI | InChI=1S/C23H34O5/c1-4-5-7-14-23(3,27)15-10-17-28-22(26)21(18(2)11-6-8-16-24)19-12-9-13-20(19)25/h4-5,7,10,14,17,19,24,27H,6,8-9,11-13,15-16H2,1-3H3/t19-,23-/m0/s1 |
| InChIKey | VCVFMCMJTCOPHI-CVDCTZTESA-N |
| XLogP | 4.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|