C16H32 — CID 57114812
2,2,4,6,6,8,8-heptamethylnon-3-ene (PubChem CID 57114812) has the molecular formula C16H32 and a molecular weight of 224.43 g/mol. Its IUPAC name is 2,2,4,6,6,8,8-heptamethylnon-3-ene.
| Compound Name | 2,2,4,6,6,8,8-heptamethylnon-3-ene |
|---|---|
| PubChem CID | 57114812 |
| Molecular Formula | C16H32 |
| Molecular Weight | 224.43 g/mol |
| Exact Mass | 224.25 |
| IUPAC Name | 2,2,4,6,6,8,8-heptamethylnon-3-ene |
| SMILES | CC(=CC(C)(C)C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H32/c1-13(10-14(2,3)4)11-16(8,9)12-15(5,6)7/h10H,11-12H2,1-9H3 |
| InChIKey | JIUVGNDAZGEZEM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.43 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|