About 6-iminocyclohex-3-ene-1,2-dione
6-iminocyclohex-3-ene-1,2-dione (PubChem CID 57115097) has the molecular formula C6H5NO2
and a molecular weight of 123.11 g/mol. Its IUPAC name is 6-iminocyclohex-3-ene-1,2-dione.
Molecular Properties
| Compound Name | 6-iminocyclohex-3-ene-1,2-dione |
| PubChem CID | 57115097 |
| Molecular Formula | C6H5NO2 |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.03 |
| IUPAC Name | 6-iminocyclohex-3-ene-1,2-dione |
| SMILES | [H]/N=C1\CC=CC(=O)C1=O |
| InChI | InChI=1S/C6H5NO2/c7-4-2-1-3-5(8)6(4)9/h1,3,7H,2H2/b7-4+ |
| InChIKey | WSOKPABXHHEJFV-QPJJXVBHSA-N |
| XLogP | 0.10 |
| TPSA | 57.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-iminocyclohex-3-ene-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iminocyclohex-3-ene-1,2-dione?
The IUPAC name of 6-iminocyclohex-3-ene-1,2-dione (CID 57115097) is 6-iminocyclohex-3-ene-1,2-dione.
What is the SMILES notation for 6-iminocyclohex-3-ene-1,2-dione?
The canonical SMILES for 6-iminocyclohex-3-ene-1,2-dione is [H]/N=C1\CC=CC(=O)C1=O.
What is the InChIKey of 6-iminocyclohex-3-ene-1,2-dione?
The InChIKey is WSOKPABXHHEJFV-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H5NO2/c7-4-2-1-3-5(8)6(4)9/h1,3,7H,2H2/b7-4+.
What are the key properties of 6-iminocyclohex-3-ene-1,2-dione?
6-iminocyclohex-3-ene-1,2-dione has a molecular weight of 123.11 g/mol, XLogP of 0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iminocyclohex-3-ene-1,2-dione is sourced from PubChem (CID 57115097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).