C21H48N2O4Si2 — CID 57115648
2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]ethyl 3-aminopropanoate (PubChem CID 57115648) has the molecular formula C21H48N2O4Si2 and a molecular weight of 448.80 g/mol. Its IUPAC name is 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]ethyl 3-aminopropanoate.
| Compound Name | 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]ethyl 3-aminopropanoate |
|---|---|
| PubChem CID | 57115648 |
| Molecular Formula | C21H48N2O4Si2 |
| Molecular Weight | 448.80 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | 2-[bis[2-[tert-butyl(dimethyl)silyl]oxyethyl]amino]ethyl 3-aminopropanoate |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(CCOC(=O)CCN)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H48N2O4Si2/c1-20(2,3)28(7,8)26-17-14-23(13-16-25-19(24)11-12-22)15-18-27-29(9,10)21(4,5)6/h11-18,22H2,1-10H3 |
| InChIKey | NCFYFXDGKJNFEW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|