About 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol
3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol (PubChem CID 57115712) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol |
| PubChem CID | 57115712 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCN(C)CCCO |
| InChI | InChI=1S/C16H33NO2/c1-13(2)15-7-6-14(3)12-16(15)19-11-9-17(4)8-5-10-18/h13-16,18H,5-12H2,1-4H3/t14-,15+,16-/m1/s1 |
| InChIKey | CVGGBSKAYBIXRZ-OWCLPIDISA-N |
| XLogP | 2.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol?
The IUPAC name of 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol (CID 57115712) is 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol.
What is the SMILES notation for 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol?
The canonical SMILES for 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol is CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCN(C)CCCO.
What is the InChIKey of 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol?
The InChIKey is CVGGBSKAYBIXRZ-OWCLPIDISA-N. The full InChI is InChI=1S/C16H33NO2/c1-13(2)15-7-6-14(3)12-16(15)19-11-9-17(4)8-5-10-18/h13-16,18H,5-12H2,1-4H3/t14-,15+,16-/m1/s1.
What are the key properties of 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol?
3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol has a molecular weight of 271.44 g/mol, XLogP of 2.78, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[methyl-[2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyethyl]amino]propan-1-ol is sourced from PubChem (CID 57115712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).