C18H14N4O4S — CID 57115904
4-[[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]methylideneamino]benzenesulfonamide (PubChem CID 57115904) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is 4-[[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]methylideneamino]benzenesulfonamide.
| Compound Name | 4-[[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]methylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 57115904 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 4-[[5-(1,3-oxazol-5-yl)-2-oxo-1,3-dihydroindol-3-yl]methylideneamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/N=C/C2C(=O)Nc3ccc(-c4cnco4)cc32)cc1 |
| InChI | InChI=1S/C18H14N4O4S/c19-27(24,25)13-4-2-12(3-5-13)21-8-15-14-7-11(17-9-20-10-26-17)1-6-16(14)22-18(15)23/h1-10,15H,(H,22,23)(H2,19,24,25)/b21-8+ |
| InChIKey | JNLCGKQCDLVQAH-ODCIPOBUSA-N |
| XLogP | 2.43 |
| TPSA | 127.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|