C12H27NO — CID 57116135
(5S,6S)-6-amino-2,3,8-trimethylnonan-5-ol (PubChem CID 57116135) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is (5S,6S)-6-amino-2,3,8-trimethylnonan-5-ol.
| Compound Name | (5S,6S)-6-amino-2,3,8-trimethylnonan-5-ol |
|---|---|
| PubChem CID | 57116135 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (5S,6S)-6-amino-2,3,8-trimethylnonan-5-ol |
| SMILES | CC(C)C[C@H](N)[C@@H](O)CC(C)C(C)C |
| InChI | InChI=1S/C12H27NO/c1-8(2)6-11(13)12(14)7-10(5)9(3)4/h8-12,14H,6-7,13H2,1-5H3/t10?,11-,12-/m0/s1 |
| InChIKey | MHOKEVUEIGXTDO-RAMGSTBQSA-N |
| XLogP | 2.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |