About bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane
bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane (PubChem CID 57116453) has the molecular formula C28H45O3P
and a molecular weight of 460.64 g/mol. Its IUPAC name is bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane.
Molecular Properties
| Compound Name | bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane |
| PubChem CID | 57116453 |
| Molecular Formula | C28H45O3P |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.31 |
| IUPAC Name | bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane |
| SMILES | CC(C)(C)c1ccc(P(O)(O)(O)c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H45O3P/c1-25(2,3)19-13-15-23(21(17-19)27(7,8)9)32(29,30,31)24-16-14-20(26(4,5)6)18-22(24)28(10,11)12/h13-18,29-31H,1-12H3 |
| InChIKey | DZLZPPSKNVBQMP-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane?
The IUPAC name of bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane (CID 57116453) is bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane.
What is the SMILES notation for bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane?
The canonical SMILES for bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane is CC(C)(C)c1ccc(P(O)(O)(O)c2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1.
What is the InChIKey of bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane?
The InChIKey is DZLZPPSKNVBQMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H45O3P/c1-25(2,3)19-13-15-23(21(17-19)27(7,8)9)32(29,30,31)24-16-14-20(26(4,5)6)18-22(24)28(10,11)12/h13-18,29-31H,1-12H3.
What are the key properties of bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane?
bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane has a molecular weight of 460.64 g/mol, XLogP of 6.10, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,4-ditert-butylphenyl)-trihydroxy-λ5-phosphane is sourced from PubChem (CID 57116453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).