C21H21NO4S2 — CID 57116472
trans-(2-phenoxy-1,3-thiazol-5-yl)methyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate (PubChem CID 57116472) has the molecular formula C21H21NO4S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is trans-(2-phenoxy-1,3-thiazol-5-yl)methyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate.
| Compound Name | trans-(2-phenoxy-1,3-thiazol-5-yl)methyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57116472 |
| Molecular Formula | C21H21NO4S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | trans-(2-phenoxy-1,3-thiazol-5-yl)methyl (1R,3S)-2,2-dimethyl-3-[(2-oxothiolan-3-ylidene)methyl]cyclopropane-1-carboxylate |
| SMILES | CC1(C)[C@H](C(=O)OCc2cnc(Oc3ccccc3)s2)[C@@H]1C=C1CCSC1=O |
| InChI | InChI=1S/C21H21NO4S2/c1-21(2)16(10-13-8-9-27-19(13)24)17(21)18(23)25-12-15-11-22-20(28-15)26-14-6-4-3-5-7-14/h3-7,10-11,16-17H,8-9,12H2,1-2H3/t16-,17-/m0/s1 |
| InChIKey | SSTPZYQQJRITMP-IRXDYDNUSA-N |
| XLogP | 4.84 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|