C17H26O6 — CID 57116762
ethyl 4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate (PubChem CID 57116762) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is ethyl 4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate.
| Compound Name | ethyl 4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 57116762 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | ethyl 4-[(3aS,4S,7S,7aR)-2,2-dimethyl-7-(2-oxoethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]-3-methylbut-2-enoate |
| SMILES | CCOC(=O)C=C(C)C[C@@H]1OC[C@H](CC=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C17H26O6/c1-5-20-14(19)9-11(2)8-13-16-15(22-17(3,4)23-16)12(6-7-18)10-21-13/h7,9,12-13,15-16H,5-6,8,10H2,1-4H3/t12-,13-,15+,16-/m0/s1 |
| InChIKey | WMPINZFXRXIIKI-UGQVUOCMSA-N |
| XLogP | 2.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|