About 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane
2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane (PubChem CID 57116844) has the molecular formula C19H36O2
and a molecular weight of 296.49 g/mol. Its IUPAC name is 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane.
Molecular Properties
| Compound Name | 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane |
| PubChem CID | 57116844 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane |
| SMILES | CCCC(C)CCCCCC(C)=CCCC1(C)OCCO1 |
| InChI | InChI=1S/C19H36O2/c1-5-10-17(2)11-7-6-8-12-18(3)13-9-14-19(4)20-15-16-21-19/h13,17H,5-12,14-16H2,1-4H3 |
| InChIKey | QXJPCLKGKPKGOJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane?
The IUPAC name of 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane (CID 57116844) is 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane.
What is the SMILES notation for 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane?
The canonical SMILES for 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane is CCCC(C)CCCCCC(C)=CCCC1(C)OCCO1.
What is the InChIKey of 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane?
The InChIKey is QXJPCLKGKPKGOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-5-10-17(2)11-7-6-8-12-18(3)13-9-14-19(4)20-15-16-21-19/h13,17H,5-12,14-16H2,1-4H3.
What are the key properties of 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane?
2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane has a molecular weight of 296.49 g/mol, XLogP of 5.86, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,10-dimethyltridec-3-enyl)-2-methyl-1,3-dioxolane is sourced from PubChem (CID 57116844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).