About 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine
2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine (PubChem CID 57116865) has the molecular formula C14H16N2S2
and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine.
Molecular Properties
| Compound Name | 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine |
| PubChem CID | 57116865 |
| Molecular Formula | C14H16N2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)nc(SSc2cc(C)cc(C)n2)c1 |
| InChI | InChI=1S/C14H16N2S2/c1-9-5-11(3)15-13(7-9)17-18-14-8-10(2)6-12(4)16-14/h5-8H,1-4H3 |
| InChIKey | SIEIXEIYCPXSQV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine?
The IUPAC name of 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine (CID 57116865) is 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine.
What is the SMILES notation for 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine?
The canonical SMILES for 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine is Cc1cc(C)nc(SSc2cc(C)cc(C)n2)c1.
What is the InChIKey of 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine?
The InChIKey is SIEIXEIYCPXSQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2S2/c1-9-5-11(3)15-13(7-9)17-18-14-8-10(2)6-12(4)16-14/h5-8H,1-4H3.
What are the key properties of 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine?
2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine has a molecular weight of 276.43 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,6-dimethyl-2-pyridinyl)disulfanyl]-4,6-dimethylpyridine is sourced from PubChem (CID 57116865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).