C2H2Cl4O3S — CID 57117054
1,2,2,2-tetrachloroethanesulfonic acid (PubChem CID 57117054) has the molecular formula C2H2Cl4O3S and a molecular weight of 247.91 g/mol. Its IUPAC name is 1,2,2,2-tetrachloroethanesulfonic acid.
| Compound Name | 1,2,2,2-tetrachloroethanesulfonic acid |
|---|---|
| PubChem CID | 57117054 |
| Molecular Formula | C2H2Cl4O3S |
| Molecular Weight | 247.91 g/mol |
| Exact Mass | 245.85 |
| IUPAC Name | 1,2,2,2-tetrachloroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C2H2Cl4O3S/c3-1(2(4,5)6)10(7,8)9/h1H,(H,7,8,9) |
| InChIKey | SBYUUHDCHQVBEC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.91 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|