About 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid
4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid (PubChem CID 57117194) has the molecular formula C27H28N2O3
and a molecular weight of 428.53 g/mol. Its IUPAC name is 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid.
Molecular Properties
| Compound Name | 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid |
| PubChem CID | 57117194 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid |
| SMILES | NC(=O)C(c1ccc(C(=O)O)cc1)C(c1ccccc1)(c1ccccc1)C1CCCCN1 |
| InChI | InChI=1S/C27H28N2O3/c28-25(30)24(19-14-16-20(17-15-19)26(31)32)27(21-9-3-1-4-10-21,22-11-5-2-6-12-22)23-13-7-8-18-29-23/h1-6,9-12,14-17,23-24,29H,7-8,13,18H2,(H2,28,30)(H,31,32) |
| InChIKey | ZTJIAIOQIRKAOP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid?
The IUPAC name of 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid (CID 57117194) is 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid.
What is the SMILES notation for 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid?
The canonical SMILES for 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid is NC(=O)C(c1ccc(C(=O)O)cc1)C(c1ccccc1)(c1ccccc1)C1CCCCN1.
What is the InChIKey of 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid?
The InChIKey is ZTJIAIOQIRKAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28N2O3/c28-25(30)24(19-14-16-20(17-15-19)26(31)32)27(21-9-3-1-4-10-21,22-11-5-2-6-12-22)23-13-7-8-18-29-23/h1-6,9-12,14-17,23-24,29H,7-8,13,18H2,(H2,28,30)(H,31,32).
What are the key properties of 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid?
4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid has a molecular weight of 428.53 g/mol, XLogP of 4.08, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-3-oxo-1,1-diphenyl-1-piperidin-2-ylpropan-2-yl)benzoic acid is sourced from PubChem (CID 57117194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).