C18H28O7S — CID 57117240
3-(1,2,3,4-tetramethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)propane-1-sulfonic acid (PubChem CID 57117240) has the molecular formula C18H28O7S and a molecular weight of 388.48 g/mol. Its IUPAC name is 3-(1,2,3,4-tetramethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)propane-1-sulfonic acid.
| Compound Name | 3-(1,2,3,4-tetramethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 57117240 |
| Molecular Formula | C18H28O7S |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-(1,2,3,4-tetramethoxy-6,7,8,9-tetrahydro-5H-benzo[7]annulen-7-yl)propane-1-sulfonic acid |
| SMILES | COc1c2c(c(OC)c(OC)c1OC)CCC(CCCS(=O)(=O)O)CC2 |
| InChI | InChI=1S/C18H28O7S/c1-22-15-13-9-7-12(6-5-11-26(19,20)21)8-10-14(13)16(23-2)18(25-4)17(15)24-3/h12H,5-11H2,1-4H3,(H,19,20,21) |
| InChIKey | ZSBAAPYMYWIGSW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|