C15H17NO6 — CID 57117603
4-[3-(2-cyanoethoxy)-3-oxoprop-1-en-2-yl]-2,6-dimethylhepta-2,5-dienedioic acid (PubChem CID 57117603) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is 4-[3-(2-cyanoethoxy)-3-oxoprop-1-en-2-yl]-2,6-dimethylhepta-2,5-dienedioic acid.
| Compound Name | 4-[3-(2-cyanoethoxy)-3-oxoprop-1-en-2-yl]-2,6-dimethylhepta-2,5-dienedioic acid |
|---|---|
| PubChem CID | 57117603 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-[3-(2-cyanoethoxy)-3-oxoprop-1-en-2-yl]-2,6-dimethylhepta-2,5-dienedioic acid |
| SMILES | C=C(C(=O)OCCC#N)C(C=C(C)C(=O)O)C=C(C)C(=O)O |
| InChI | InChI=1S/C15H17NO6/c1-9(13(17)18)7-12(8-10(2)14(19)20)11(3)15(21)22-6-4-5-16/h7-8,12H,3-4,6H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | DFGBCBJTAVSZMA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 124.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|