C26H28Cl2N4 — CID 57117786
N',N'-bis(7-chloroquinolin-4-yl)octane-1,8-diamine (PubChem CID 57117786) has the molecular formula C26H28Cl2N4 and a molecular weight of 467.44 g/mol. Its IUPAC name is N',N'-bis(7-chloroquinolin-4-yl)octane-1,8-diamine.
| Compound Name | N',N'-bis(7-chloroquinolin-4-yl)octane-1,8-diamine |
|---|---|
| PubChem CID | 57117786 |
| Molecular Formula | C26H28Cl2N4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N',N'-bis(7-chloroquinolin-4-yl)octane-1,8-diamine |
| SMILES | NCCCCCCCCN(c1ccnc2cc(Cl)ccc12)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H28Cl2N4/c27-19-7-9-21-23(17-19)30-14-11-25(21)32(16-6-4-2-1-3-5-13-29)26-12-15-31-24-18-20(28)8-10-22(24)26/h7-12,14-15,17-18H,1-6,13,16,29H2 |
| InChIKey | STBOVSVTDJZTNG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|