C20H32NO3S2+ — CID 57117862
(1R,2R,4R)-4-(1-adamantylsulfanyl)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57117862) has the molecular formula C20H32NO3S2+ and a molecular weight of 398.61 g/mol. Its IUPAC name is (1R,2R,4R)-4-(1-adamantylsulfanyl)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (1R,2R,4R)-4-(1-adamantylsulfanyl)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57117862 |
| Molecular Formula | C20H32NO3S2+ |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | (1R,2R,4R)-4-(1-adamantylsulfanyl)-2-methyl-1-(2-methyl-3-sulfanylpropanoyl)pyrrolidin-1-ium-1-carboxylic acid |
| SMILES | CC(CS)C(=O)[N@@+]1(C(=O)O)C[C@H](SC23CC4CC(CC(C4)C2)C3)C[C@H]1C |
| InChI | InChI=1S/C20H31NO3S2/c1-12(11-25)18(22)21(19(23)24)10-17(3-13(21)2)26-20-7-14-4-15(8-20)6-16(5-14)9-20/h12-17H,3-11H2,1-2H3,(H-,23,24,25)/p+1/t12?,13-,14?,15?,16?,17-,20?,21-/m1/s1 |
| InChIKey | OLJSKVYWRQIXRW-DRADFJGNSA-O |
| XLogP | 4.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|