C8H16O2S — CID 57117933
2-methyl-2-(3-methylsulfanylpropyl)-1,3-dioxolane (PubChem CID 57117933) has the molecular formula C8H16O2S and a molecular weight of 176.28 g/mol. Its IUPAC name is 2-methyl-2-(3-methylsulfanylpropyl)-1,3-dioxolane.
| Compound Name | 2-methyl-2-(3-methylsulfanylpropyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 57117933 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-methyl-2-(3-methylsulfanylpropyl)-1,3-dioxolane |
| SMILES | CSCCCC1(C)OCCO1 |
| InChI | InChI=1S/C8H16O2S/c1-8(4-3-7-11-2)9-5-6-10-8/h3-7H2,1-2H3 |
| InChIKey | ZUJGLNIPFKWDCA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|