C23H23ClFNO5S — CID 57118262
cyclohexyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzenecarbothioyl]oxyacetate (PubChem CID 57118262) has the molecular formula C23H23ClFNO5S and a molecular weight of 479.96 g/mol. Its IUPAC name is cyclohexyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzenecarbothioyl]oxyacetate.
| Compound Name | cyclohexyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzenecarbothioyl]oxyacetate |
|---|---|
| PubChem CID | 57118262 |
| Molecular Formula | C23H23ClFNO5S |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | cyclohexyl 2-[2-chloro-5-(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)-4-fluorobenzenecarbothioyl]oxyacetate |
| SMILES | O=C(COC(=S)c1cc(N2C(=O)C3=C(CCCC3)C2=O)c(F)cc1Cl)OC1CCCCC1 |
| InChI | InChI=1S/C23H23ClFNO5S/c24-17-11-18(25)19(26-21(28)14-8-4-5-9-15(14)22(26)29)10-16(17)23(32)30-12-20(27)31-13-6-2-1-3-7-13/h10-11,13H,1-9,12H2 |
| InChIKey | DNPMBSJQNFYHEP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|