About 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate
2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate (PubChem CID 57118592) has the molecular formula C24H38O6
and a molecular weight of 422.56 g/mol. Its IUPAC name is 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate.
Molecular Properties
| Compound Name | 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate |
| PubChem CID | 57118592 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate |
| SMILES | CC(=O)OCC=C1CC[C@@H](OC(C)=O)C(C)(CCCC(C)C(=O)CC=C(C)C)OC1 |
| InChI | InChI=1S/C24H38O6/c1-17(2)9-11-22(27)18(3)8-7-14-24(6)23(30-20(5)26)12-10-21(16-29-24)13-15-28-19(4)25/h9,13,18,23H,7-8,10-12,14-16H2,1-6H3/t18?,23-,24?/m1/s1 |
| InChIKey | JAQGMVZNBQCCQP-WHKWTHTOSA-N |
| XLogP | 4.71 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate?
The IUPAC name of 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate (CID 57118592) is 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate.
What is the SMILES notation for 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate?
The canonical SMILES for 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate is CC(=O)OCC=C1CC[C@@H](OC(C)=O)C(C)(CCCC(C)C(=O)CC=C(C)C)OC1.
What is the InChIKey of 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate?
The InChIKey is JAQGMVZNBQCCQP-WHKWTHTOSA-N. The full InChI is InChI=1S/C24H38O6/c1-17(2)9-11-22(27)18(3)8-7-14-24(6)23(30-20(5)26)12-10-21(16-29-24)13-15-28-19(4)25/h9,13,18,23H,7-8,10-12,14-16H2,1-6H3/t18?,23-,24?/m1/s1.
What are the key properties of 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate?
2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate has a molecular weight of 422.56 g/mol, XLogP of 4.71, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6R)-6-acetyloxy-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyloxepan-3-ylidene]ethyl acetate is sourced from PubChem (CID 57118592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).