C32H43N5O4 — CID 57118885
(2R)-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-morpholin-4-ylpentanamide (PubChem CID 57118885) has the molecular formula C32H43N5O4 and a molecular weight of 561.73 g/mol. Its IUPAC name is (2R)-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-morpholin-4-ylpentanamide.
| Compound Name | (2R)-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-morpholin-4-ylpentanamide |
|---|---|
| PubChem CID | 57118885 |
| Molecular Formula | C32H43N5O4 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.33 |
| IUPAC Name | (2R)-N-[(2S)-1-(3-imidazol-1-ylpropylamino)-1-oxo-3-(4-phenylmethoxyphenyl)propan-2-yl]-4-methyl-2-morpholin-4-ylpentanamide |
| SMILES | CC(C)C[C@H](C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)NCCCn1ccnc1)N1CCOCC1 |
| InChI | InChI=1S/C32H43N5O4/c1-25(2)21-30(37-17-19-40-20-18-37)32(39)35-29(31(38)34-13-6-15-36-16-14-33-24-36)22-26-9-11-28(12-10-26)41-23-27-7-4-3-5-8-27/h3-5,7-12,14,16,24-25,29-30H,6,13,15,17-23H2,1-2H3,(H,34,38)(H,35,39)/t29-,30+/m0/s1 |
| InChIKey | XUSLMODZUFYNNE-XZWHSSHBSA-N |
| XLogP | 3.44 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|