C22H27NOS — CID 57119221
5-methyl-7-pentoxy-3-(2,4,6-trimethylphenyl)thieno[3,2-b]pyridine (PubChem CID 57119221) has the molecular formula C22H27NOS and a molecular weight of 353.53 g/mol. Its IUPAC name is 5-methyl-7-pentoxy-3-(2,4,6-trimethylphenyl)thieno[3,2-b]pyridine.
| Compound Name | 5-methyl-7-pentoxy-3-(2,4,6-trimethylphenyl)thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 57119221 |
| Molecular Formula | C22H27NOS |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 5-methyl-7-pentoxy-3-(2,4,6-trimethylphenyl)thieno[3,2-b]pyridine |
| SMILES | CCCCCOc1cc(C)nc2c(-c3c(C)cc(C)cc3C)csc12 |
| InChI | InChI=1S/C22H27NOS/c1-6-7-8-9-24-19-12-17(5)23-21-18(13-25-22(19)21)20-15(3)10-14(2)11-16(20)4/h10-13H,6-9H2,1-5H3 |
| InChIKey | ALDJRORKTBMKFR-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|