About 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone
1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone (PubChem CID 57119241) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone.
Molecular Properties
| Compound Name | 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone |
| PubChem CID | 57119241 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone |
| SMILES | O=C(CN1C=CSC1)c1ccccc1 |
| InChI | InChI=1S/C11H11NOS/c13-11(8-12-6-7-14-9-12)10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | PQTHSTJAJKUPPR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone?
The IUPAC name of 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone (CID 57119241) is 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone.
What is the SMILES notation for 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone?
The canonical SMILES for 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone is O=C(CN1C=CSC1)c1ccccc1.
What is the InChIKey of 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone?
The InChIKey is PQTHSTJAJKUPPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c13-11(8-12-6-7-14-9-12)10-4-2-1-3-5-10/h1-7H,8-9H2.
What are the key properties of 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone?
1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone has a molecular weight of 205.28 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-(2H-1,3-thiazol-3-yl)ethanone is sourced from PubChem (CID 57119241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).