C21H25FN6O3 — CID 57119406
N-[[3-[3-fluoro-4-[4-(5-methylpyrazin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide (PubChem CID 57119406) has the molecular formula C21H25FN6O3 and a molecular weight of 428.47 g/mol. Its IUPAC name is N-[[3-[3-fluoro-4-[4-(5-methylpyrazin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide.
| Compound Name | N-[[3-[3-fluoro-4-[4-(5-methylpyrazin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide |
|---|---|
| PubChem CID | 57119406 |
| Molecular Formula | C21H25FN6O3 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[[3-[3-fluoro-4-[4-(5-methylpyrazin-2-yl)piperazin-1-yl]phenyl]-2-oxo-1,3-oxazolidin-4-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1COC(=O)N1c1ccc(N2CCN(c3cnc(C)cn3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H25FN6O3/c1-14-10-25-20(12-23-14)27-7-5-26(6-8-27)19-4-3-16(9-18(19)22)28-17(11-24-15(2)29)13-31-21(28)30/h3-4,9-10,12,17H,5-8,11,13H2,1-2H3,(H,24,29) |
| InChIKey | ZNTXDUWEHJVHSL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|