About 2-amino-1-hydroxyicosa-11,14-dien-3-one
2-amino-1-hydroxyicosa-11,14-dien-3-one (PubChem CID 57119524) has the molecular formula C20H37NO2
and a molecular weight of 323.52 g/mol. Its IUPAC name is 2-amino-1-hydroxyicosa-11,14-dien-3-one.
Molecular Properties
| Compound Name | 2-amino-1-hydroxyicosa-11,14-dien-3-one |
| PubChem CID | 57119524 |
| Molecular Formula | C20H37NO2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 323.28 |
| IUPAC Name | 2-amino-1-hydroxyicosa-11,14-dien-3-one |
| SMILES | CCCCCC=CCC=CCCCCCCCC(=O)C(N)CO |
| InChI | InChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h6-7,9-10,19,22H,2-5,8,11-18,21H2,1H3 |
| InChIKey | WMNLHEVCWHADCS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-1-hydroxyicosa-11,14-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-hydroxyicosa-11,14-dien-3-one?
The IUPAC name of 2-amino-1-hydroxyicosa-11,14-dien-3-one (CID 57119524) is 2-amino-1-hydroxyicosa-11,14-dien-3-one.
What is the SMILES notation for 2-amino-1-hydroxyicosa-11,14-dien-3-one?
The canonical SMILES for 2-amino-1-hydroxyicosa-11,14-dien-3-one is CCCCCC=CCC=CCCCCCCCC(=O)C(N)CO.
What is the InChIKey of 2-amino-1-hydroxyicosa-11,14-dien-3-one?
The InChIKey is WMNLHEVCWHADCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(21)18-22/h6-7,9-10,19,22H,2-5,8,11-18,21H2,1H3.
What are the key properties of 2-amino-1-hydroxyicosa-11,14-dien-3-one?
2-amino-1-hydroxyicosa-11,14-dien-3-one has a molecular weight of 323.52 g/mol, XLogP of 4.69, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-hydroxyicosa-11,14-dien-3-one is sourced from PubChem (CID 57119524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).