C18H18O7 — CID 57119637
4-[2-[4-(2-hydroxyethoxy)phenoxy]ethoxycarbonyl]benzoic acid (PubChem CID 57119637) has the molecular formula C18H18O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-[2-[4-(2-hydroxyethoxy)phenoxy]ethoxycarbonyl]benzoic acid.
| Compound Name | 4-[2-[4-(2-hydroxyethoxy)phenoxy]ethoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 57119637 |
| Molecular Formula | C18H18O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-[2-[4-(2-hydroxyethoxy)phenoxy]ethoxycarbonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)OCCOc2ccc(OCCO)cc2)cc1 |
| InChI | InChI=1S/C18H18O7/c19-9-10-23-15-5-7-16(8-6-15)24-11-12-25-18(22)14-3-1-13(2-4-14)17(20)21/h1-8,19H,9-12H2,(H,20,21) |
| InChIKey | NERHLKCNKAHYTA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|