About 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid
2-(2-formamido-1,3-thiazol-4-yl)butanoic acid (PubChem CID 57119960) has the molecular formula C8H10N2O3S
and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid.
Molecular Properties
| Compound Name | 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid |
| PubChem CID | 57119960 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid |
| SMILES | CCC(C(=O)O)c1csc(NC=O)n1 |
| InChI | InChI=1S/C8H10N2O3S/c1-2-5(7(12)13)6-3-14-8(10-6)9-4-11/h3-5H,2H2,1H3,(H,12,13)(H,9,10,11) |
| InChIKey | CSINRPUKDFGWAB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid?
The IUPAC name of 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid (CID 57119960) is 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid.
What is the SMILES notation for 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid?
The canonical SMILES for 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid is CCC(C(=O)O)c1csc(NC=O)n1.
What is the InChIKey of 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid?
The InChIKey is CSINRPUKDFGWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-2-5(7(12)13)6-3-14-8(10-6)9-4-11/h3-5H,2H2,1H3,(H,12,13)(H,9,10,11).
What are the key properties of 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid?
2-(2-formamido-1,3-thiazol-4-yl)butanoic acid has a molecular weight of 214.25 g/mol, XLogP of 1.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-formamido-1,3-thiazol-4-yl)butanoic acid is sourced from PubChem (CID 57119960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).