C17H27FO2 — CID 57120281
(4R)-1-[(3aR,4R,5R,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4-fluoro-4-methyloct-1-en-3-one (PubChem CID 57120281) has the molecular formula C17H27FO2 and a molecular weight of 282.40 g/mol. Its IUPAC name is (4R)-1-[(3aR,4R,5R,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4-fluoro-4-methyloct-1-en-3-one.
| Compound Name | (4R)-1-[(3aR,4R,5R,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4-fluoro-4-methyloct-1-en-3-one |
|---|---|
| PubChem CID | 57120281 |
| Molecular Formula | C17H27FO2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (4R)-1-[(3aR,4R,5R,6aS)-5-methyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4-fluoro-4-methyloct-1-en-3-one |
| SMILES | CCCC[C@@](C)(F)C(=O)C=C[C@@H]1[C@H]2CCO[C@H]2C[C@H]1C |
| InChI | InChI=1S/C17H27FO2/c1-4-5-9-17(3,18)16(19)7-6-13-12(2)11-15-14(13)8-10-20-15/h6-7,12-15H,4-5,8-11H2,1-3H3/t12-,13+,14-,15+,17-/m1/s1 |
| InChIKey | JHPVIRDCNFFZED-LBKYZSNHSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|