About 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine
3,5-dipyridin-2-yl-1,2,4-triazol-4-amine (PubChem CID 571203) has the molecular formula C12H10N6
and a molecular weight of 238.25 g/mol. Its IUPAC name is 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine.
Molecular Properties
| Compound Name | 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine |
| PubChem CID | 571203 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine |
| SMILES | Nn1c(-c2ccccn2)nnc1-c1ccccn1 |
| InChI | InChI=1S/C12H10N6/c13-18-11(9-5-1-3-7-14-9)16-17-12(18)10-6-2-4-8-15-10/h1-8H,13H2 |
| InChIKey | VHRKXLULSZZZQT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine?
The IUPAC name of 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine (CID 571203) is 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine.
What is the SMILES notation for 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine?
The canonical SMILES for 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine is Nn1c(-c2ccccn2)nnc1-c1ccccn1.
What is the InChIKey of 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine?
The InChIKey is VHRKXLULSZZZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N6/c13-18-11(9-5-1-3-7-14-9)16-17-12(18)10-6-2-4-8-15-10/h1-8H,13H2.
What are the key properties of 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine?
3,5-dipyridin-2-yl-1,2,4-triazol-4-amine has a molecular weight of 238.25 g/mol, XLogP of 1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dipyridin-2-yl-1,2,4-triazol-4-amine is sourced from PubChem (CID 571203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).