About tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate
tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate (PubChem CID 57120685) has the molecular formula C12H19N3O6
and a molecular weight of 301.30 g/mol. Its IUPAC name is tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate |
| PubChem CID | 57120685 |
| Molecular Formula | C12H19N3O6 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C12H19N3O6/c1-12(2,3)20-10(18)13-6-7-14-11(19)21-15-8(16)4-5-9(15)17/h4-5,16-17H,6-7H2,1-3H3,(H,13,18)(H,14,19) |
| InChIKey | HISFHVAXGFGWKN-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate?
The IUPAC name of tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate (CID 57120685) is tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate is CC(C)(C)OC(=O)NCCNC(=O)On1c(O)ccc1O.
What is the InChIKey of tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate?
The InChIKey is HISFHVAXGFGWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O6/c1-12(2,3)20-10(18)13-6-7-14-11(19)21-15-8(16)4-5-9(15)17/h4-5,16-17H,6-7H2,1-3H3,(H,13,18)(H,14,19).
What are the key properties of tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate?
tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate has a molecular weight of 301.30 g/mol, XLogP of 0.56, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-[(2,5-dihydroxypyrrol-1-yl)oxycarbonylamino]ethyl]carbamate is sourced from PubChem (CID 57120685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).