C9H8F5N3 — CID 57120718
2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]guanidine (PubChem CID 57120718) has the molecular formula C9H8F5N3 and a molecular weight of 253.17 g/mol. Its IUPAC name is 2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]guanidine.
| Compound Name | 2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 57120718 |
| Molecular Formula | C9H8F5N3 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-[3-(1,1,2,2,2-pentafluoroethyl)phenyl]guanidine |
| SMILES | NC(N)=Nc1cccc(C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F5N3/c10-8(11,9(12,13)14)5-2-1-3-6(4-5)17-7(15)16/h1-4H,(H4,15,16,17) |
| InChIKey | YVTGVONEIRTXLL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|