C8H14N2OS — CID 57120975
4-(cyclohexylmethyl)-3H-1,2,3,5-oxathiadiazole (PubChem CID 57120975) has the molecular formula C8H14N2OS and a molecular weight of 186.28 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-3H-1,2,3,5-oxathiadiazole.
| Compound Name | 4-(cyclohexylmethyl)-3H-1,2,3,5-oxathiadiazole |
|---|---|
| PubChem CID | 57120975 |
| Molecular Formula | C8H14N2OS |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 4-(cyclohexylmethyl)-3H-1,2,3,5-oxathiadiazole |
| SMILES | C1CCC(CC2=NOSN2)CC1 |
| InChI | InChI=1S/C8H14N2OS/c1-2-4-7(5-3-1)6-8-9-11-12-10-8/h7H,1-6H2,(H,9,10) |
| InChIKey | WIWOFJJOPMOQFL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|