C16H10N6O6S2 — CID 57120992
4-[7-(4-sulfo-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3,5-triazine-2-sulfonic acid (PubChem CID 57120992) has the molecular formula C16H10N6O6S2 and a molecular weight of 446.43 g/mol. Its IUPAC name is 4-[7-(4-sulfo-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3,5-triazine-2-sulfonic acid.
| Compound Name | 4-[7-(4-sulfo-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3,5-triazine-2-sulfonic acid |
|---|---|
| PubChem CID | 57120992 |
| Molecular Formula | C16H10N6O6S2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | 4-[7-(4-sulfo-1,3,5-triazin-2-yl)naphthalen-2-yl]-1,3,5-triazine-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1ncnc(-c2ccc3ccc(-c4ncnc(S(=O)(=O)O)n4)cc3c2)n1 |
| InChI | InChI=1S/C16H10N6O6S2/c23-29(24,25)15-19-7-17-13(21-15)10-3-1-9-2-4-11(6-12(9)5-10)14-18-8-20-16(22-14)30(26,27)28/h1-8H,(H,23,24,25)(H,26,27,28) |
| InChIKey | DHCOJSWVRABYMY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 186.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|