C20H34O7 — CID 57121033
methyl 5,5-bis[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate (PubChem CID 57121033) has the molecular formula C20H34O7 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl 5,5-bis[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate.
| Compound Name | methyl 5,5-bis[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 57121033 |
| Molecular Formula | C20H34O7 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | methyl 5,5-bis[3-hydroxy-2-(hydroxymethyl)-2-methylpropyl]-2-oxo-1,3,3a,4,6,6a-hexahydropentalene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)CC2CC(CC(C)(CO)CO)(CC(C)(CO)CO)CC21 |
| InChI | InChI=1S/C20H34O7/c1-18(9-21,10-22)7-20(8-19(2,11-23)12-24)5-13-4-15(25)16(14(13)6-20)17(26)27-3/h13-14,16,21-24H,4-12H2,1-3H3 |
| InChIKey | WGXBGKCXUFXXOV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|