C16H20F6O3 — CID 57121288
1,1,1-trifluoro-3-[2-(2,2,2-trifluoroacetyl)hex-1-enoxymethylidene]heptan-2-one (PubChem CID 57121288) has the molecular formula C16H20F6O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[2-(2,2,2-trifluoroacetyl)hex-1-enoxymethylidene]heptan-2-one.
| Compound Name | 1,1,1-trifluoro-3-[2-(2,2,2-trifluoroacetyl)hex-1-enoxymethylidene]heptan-2-one |
|---|---|
| PubChem CID | 57121288 |
| Molecular Formula | C16H20F6O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1,1,1-trifluoro-3-[2-(2,2,2-trifluoroacetyl)hex-1-enoxymethylidene]heptan-2-one |
| SMILES | CCCCC(=COC=C(CCCC)C(=O)C(F)(F)F)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H20F6O3/c1-3-5-7-11(13(23)15(17,18)19)9-25-10-12(8-6-4-2)14(24)16(20,21)22/h9-10H,3-8H2,1-2H3 |
| InChIKey | LNDKQZMOHDHTFV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|