About 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide
2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide (PubChem CID 57121466) has the molecular formula C20H31NO4
and a molecular weight of 349.47 g/mol. Its IUPAC name is 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide.
Molecular Properties
| Compound Name | 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide |
| PubChem CID | 57121466 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide |
| SMILES | CC(C)=CCC(=O)C(C)CCC[C@]1(C)OCC(=CC(N)=O)CCC1=O |
| InChI | InChI=1S/C20H31NO4/c1-14(2)7-9-17(22)15(3)6-5-11-20(4)18(23)10-8-16(13-25-20)12-19(21)24/h7,12,15H,5-6,8-11,13H2,1-4H3,(H2,21,24)/t15?,20-/m0/s1 |
| InChIKey | YUEKPCGACOZLLU-MBABXSBOSA-N |
| XLogP | 3.27 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide?
The IUPAC name of 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide (CID 57121466) is 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide.
What is the SMILES notation for 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide?
The canonical SMILES for 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide is CC(C)=CCC(=O)C(C)CCC[C@]1(C)OCC(=CC(N)=O)CCC1=O.
What is the InChIKey of 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide?
The InChIKey is YUEKPCGACOZLLU-MBABXSBOSA-N. The full InChI is InChI=1S/C20H31NO4/c1-14(2)7-9-17(22)15(3)6-5-11-20(4)18(23)10-8-16(13-25-20)12-19(21)24/h7,12,15H,5-6,8-11,13H2,1-4H3,(H2,21,24)/t15?,20-/m0/s1.
What are the key properties of 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide?
2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide has a molecular weight of 349.47 g/mol, XLogP of 3.27, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7S)-7-(4,8-dimethyl-5-oxonon-7-enyl)-7-methyl-6-oxooxepan-3-ylidene]acetamide is sourced from PubChem (CID 57121466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).