C15H27N2O5+ — CID 57121848
(2R)-1-[(2S)-2-amino-4-carboxy-5,5-dimethylhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid (PubChem CID 57121848) has the molecular formula C15H27N2O5+ and a molecular weight of 315.39 g/mol. Its IUPAC name is (2R)-1-[(2S)-2-amino-4-carboxy-5,5-dimethylhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid.
| Compound Name | (2R)-1-[(2S)-2-amino-4-carboxy-5,5-dimethylhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 57121848 |
| Molecular Formula | C15H27N2O5+ |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (2R)-1-[(2S)-2-amino-4-carboxy-5,5-dimethylhexanoyl]-2-methylpyrrolidin-1-ium-1-carboxylic acid |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)O)C(=O)[C@@H](N)CC(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H26N2O5/c1-9-6-5-7-17(9,14(21)22)12(18)11(16)8-10(13(19)20)15(2,3)4/h9-11H,5-8,16H2,1-4H3,(H-,19,20,21,22)/p+1/t9-,10?,11+,17?/m1/s1 |
| InChIKey | DNBYBMVAZLMADV-NFNPTBNRSA-O |
| XLogP | 1.65 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|