About [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate
[1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 57122466) has the molecular formula C13H21F3O3S2
and a molecular weight of 346.44 g/mol. Its IUPAC name is [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| PubChem CID | 57122466 |
| Molecular Formula | C13H21F3O3S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CS(C)(OS(=O)(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C13H21F3O3S2/c1-20(2,19-21(17,18)13(14,15)16)12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,3-8H2,1-2H3 |
| InChIKey | PGWSWMYNDHMQEK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The IUPAC name of [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate (CID 57122466) is [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate.
What is the SMILES notation for [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The canonical SMILES for [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate is CS(C)(OS(=O)(=O)C(F)(F)F)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate?
The InChIKey is PGWSWMYNDHMQEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21F3O3S2/c1-20(2,19-21(17,18)13(14,15)16)12-6-9-3-10(7-12)5-11(4-9)8-12/h9-11H,3-8H2,1-2H3.
What are the key properties of [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate?
[1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate has a molecular weight of 346.44 g/mol, XLogP of 3.80, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-adamantyl(dimethyl)-λ4-sulfanyl] trifluoromethanesulfonate is sourced from PubChem (CID 57122466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).