About 5-propan-2-yl-1,4-dihydropyrimidine
5-propan-2-yl-1,4-dihydropyrimidine (PubChem CID 57122773) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 5-propan-2-yl-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,4-dihydropyrimidine |
| PubChem CID | 57122773 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 5-propan-2-yl-1,4-dihydropyrimidine |
| SMILES | CC(C)C1=CNC=NC1 |
| InChI | InChI=1S/C7H12N2/c1-6(2)7-3-8-5-9-4-7/h3,5-6H,4H2,1-2H3,(H,8,9) |
| InChIKey | BPMYXXZXGHYXPE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,4-dihydropyrimidine?
The IUPAC name of 5-propan-2-yl-1,4-dihydropyrimidine (CID 57122773) is 5-propan-2-yl-1,4-dihydropyrimidine.
What is the SMILES notation for 5-propan-2-yl-1,4-dihydropyrimidine?
The canonical SMILES for 5-propan-2-yl-1,4-dihydropyrimidine is CC(C)C1=CNC=NC1.
What is the InChIKey of 5-propan-2-yl-1,4-dihydropyrimidine?
The InChIKey is BPMYXXZXGHYXPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-6(2)7-3-8-5-9-4-7/h3,5-6H,4H2,1-2H3,(H,8,9).
What are the key properties of 5-propan-2-yl-1,4-dihydropyrimidine?
5-propan-2-yl-1,4-dihydropyrimidine has a molecular weight of 124.19 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,4-dihydropyrimidine is sourced from PubChem (CID 57122773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).