C10H18BClO2 — CID 57122787
2-[(1S)-1-chlorobut-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 57122787) has the molecular formula C10H18BClO2 and a molecular weight of 216.52 g/mol. Its IUPAC name is 2-[(1S)-1-chlorobut-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1S)-1-chlorobut-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 57122787 |
| Molecular Formula | C10H18BClO2 |
| Molecular Weight | 216.52 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-[(1S)-1-chlorobut-3-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CC[C@@H](Cl)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C10H18BClO2/c1-6-7-8(12)11-13-9(2,3)10(4,5)14-11/h6,8H,1,7H2,2-5H3/t8-/m1/s1 |
| InChIKey | USSXOVVQQKLUOT-MRVPVSSYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|