C17H20N2O2 — CID 57122881
1-methoxy-5,6,8a,9,10,11,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one (PubChem CID 57122881) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-methoxy-5,6,8a,9,10,11,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one.
| Compound Name | 1-methoxy-5,6,8a,9,10,11,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
|---|---|
| PubChem CID | 57122881 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-methoxy-5,6,8a,9,10,11,13,13a-octahydroisoquinolino[2,1-g][1,6]naphthyridin-8-one |
| SMILES | COc1cccc2c1C1CC3=NCCCC3C(=O)N1CC2 |
| InChI | InChI=1S/C17H20N2O2/c1-21-15-6-2-4-11-7-9-19-14(16(11)15)10-13-12(17(19)20)5-3-8-18-13/h2,4,6,12,14H,3,5,7-10H2,1H3 |
| InChIKey | DTEAOFIVGKGXEP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |