About (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol
(2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol (PubChem CID 57122961) has the molecular formula C9H18O4
and a molecular weight of 190.24 g/mol. Its IUPAC name is (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol.
Molecular Properties
| Compound Name | (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol |
| PubChem CID | 57122961 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol |
| SMILES | C=CC[C@@H](CO)[C@@H](CO)OCOC |
| InChI | InChI=1S/C9H18O4/c1-3-4-8(5-10)9(6-11)13-7-12-2/h3,8-11H,1,4-7H2,2H3/t8-,9+/m0/s1 |
| InChIKey | UZRLGOOVQOKHPB-DTWKUNHWSA-N |
| XLogP | 0.15 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol?
The IUPAC name of (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol (CID 57122961) is (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol.
What is the SMILES notation for (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol?
The canonical SMILES for (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol is C=CC[C@@H](CO)[C@@H](CO)OCOC.
What is the InChIKey of (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol?
The InChIKey is UZRLGOOVQOKHPB-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H18O4/c1-3-4-8(5-10)9(6-11)13-7-12-2/h3,8-11H,1,4-7H2,2H3/t8-,9+/m0/s1.
What are the key properties of (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol?
(2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol has a molecular weight of 190.24 g/mol, XLogP of 0.15, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(methoxymethoxy)-3-prop-2-enylbutane-1,4-diol is sourced from PubChem (CID 57122961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).