C21H32N4O4 — CID 57123058
(2R,3R)-3-(aminomethyl)-2-benzyl-N-tert-butyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-3-methylbutanamide (PubChem CID 57123058) has the molecular formula C21H32N4O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is (2R,3R)-3-(aminomethyl)-2-benzyl-N-tert-butyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-3-methylbutanamide.
| Compound Name | (2R,3R)-3-(aminomethyl)-2-benzyl-N-tert-butyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 57123058 |
| Molecular Formula | C21H32N4O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (2R,3R)-3-(aminomethyl)-2-benzyl-N-tert-butyl-2-(2,5-dihydroxypyrrol-1-yl)-4-(hydroxyamino)-3-methylbutanamide |
| SMILES | CC(C)(C)NC(=O)[C@](Cc1ccccc1)(n1c(O)ccc1O)[C@](C)(CN)CNO |
| InChI | InChI=1S/C21H32N4O4/c1-19(2,3)24-18(28)21(20(4,13-22)14-23-29,12-15-8-6-5-7-9-15)25-16(26)10-11-17(25)27/h5-11,23,26-27,29H,12-14,22H2,1-4H3,(H,24,28)/t20-,21+/m1/s1 |
| InChIKey | GHNLKNWIOHKEHA-RTWAWAEBSA-N |
| XLogP | 1.70 |
| TPSA | 132.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|