C7H11N3O5 — CID 57123327
1,3-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 57123327) has the molecular formula C7H11N3O5 and a molecular weight of 217.18 g/mol. Its IUPAC name is 1,3-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 57123327 |
| Molecular Formula | C7H11N3O5 |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 1,3-bis(2-hydroxyethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCO)c(=O)n1CCO |
| InChI | InChI=1S/C7H11N3O5/c11-3-1-9-5(13)8-6(14)10(2-4-12)7(9)15/h11-12H,1-4H2,(H,8,13,14) |
| InChIKey | PNMXCUGTRRGOHD-UHFFFAOYSA-N |
| XLogP | -3.32 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | -3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |