About 5-cyclohexa-1,4-dien-1-ylpentanamide
5-cyclohexa-1,4-dien-1-ylpentanamide (PubChem CID 57123378) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 5-cyclohexa-1,4-dien-1-ylpentanamide.
Molecular Properties
| Compound Name | 5-cyclohexa-1,4-dien-1-ylpentanamide |
| PubChem CID | 57123378 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 5-cyclohexa-1,4-dien-1-ylpentanamide |
| SMILES | NC(=O)CCCCC1=CCC=CC1 |
| InChI | InChI=1S/C11H17NO/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-2,7H,3-6,8-9H2,(H2,12,13) |
| InChIKey | JEQLLUSSXBCQSK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclohexa-1,4-dien-1-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclohexa-1,4-dien-1-ylpentanamide?
The IUPAC name of 5-cyclohexa-1,4-dien-1-ylpentanamide (CID 57123378) is 5-cyclohexa-1,4-dien-1-ylpentanamide.
What is the SMILES notation for 5-cyclohexa-1,4-dien-1-ylpentanamide?
The canonical SMILES for 5-cyclohexa-1,4-dien-1-ylpentanamide is NC(=O)CCCCC1=CCC=CC1.
What is the InChIKey of 5-cyclohexa-1,4-dien-1-ylpentanamide?
The InChIKey is JEQLLUSSXBCQSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c12-11(13)9-5-4-8-10-6-2-1-3-7-10/h1-2,7H,3-6,8-9H2,(H2,12,13).
What are the key properties of 5-cyclohexa-1,4-dien-1-ylpentanamide?
5-cyclohexa-1,4-dien-1-ylpentanamide has a molecular weight of 179.26 g/mol, XLogP of 2.31, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclohexa-1,4-dien-1-ylpentanamide is sourced from PubChem (CID 57123378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).