C21H26N4O7S — CID 57123549
1-[3-(hydroxyamino)-3-oxo-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]propyl]-3,4,4-trimethyl-2,5-dioxoimidazolidine (PubChem CID 57123549) has the molecular formula C21H26N4O7S and a molecular weight of 478.53 g/mol. Its IUPAC name is 1-[3-(hydroxyamino)-3-oxo-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]propyl]-3,4,4-trimethyl-2,5-dioxoimidazolidine.
| Compound Name | 1-[3-(hydroxyamino)-3-oxo-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]propyl]-3,4,4-trimethyl-2,5-dioxoimidazolidine |
|---|---|
| PubChem CID | 57123549 |
| Molecular Formula | C21H26N4O7S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 1-[3-(hydroxyamino)-3-oxo-2-[sulfino(6,7,8,9-tetrahydrodibenzofuran-3-yl)amino]propyl]-3,4,4-trimethyl-2,5-dioxoimidazolidine |
| SMILES | CN1C(=O)N(CC(C(=O)NO)N(c2ccc3c4c(oc3c2)CCCC4)S(=O)O)C(=O)C1(C)C |
| InChI | InChI=1S/C21H26N4O7S/c1-21(2)19(27)24(20(28)23(21)3)11-15(18(26)22-29)25(33(30)31)12-8-9-14-13-6-4-5-7-16(13)32-17(14)10-12/h8-10,15,29H,4-7,11H2,1-3H3,(H,22,26)(H,30,31) |
| InChIKey | RRRVEANSCSSEMO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|